C13H21Cl — CID 143267861
(2Z,4Z)-5-(1-chloroethenyl)-7-methyldeca-2,4-diene (PubChem CID 143267861) has the molecular formula C13H21Cl and a molecular weight of 212.76 g/mol. Its IUPAC name is (2Z,4Z)-5-(1-chloroethenyl)-7-methyldeca-2,4-diene.
| Compound Name | (2Z,4Z)-5-(1-chloroethenyl)-7-methyldeca-2,4-diene |
|---|---|
| PubChem CID | 143267861 |
| Molecular Formula | C13H21Cl |
| Molecular Weight | 212.76 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2Z,4Z)-5-(1-chloroethenyl)-7-methyldeca-2,4-diene |
| SMILES | C=C(Cl)/C(=C\C=C/C)CC(C)CCC |
| InChI | InChI=1S/C13H21Cl/c1-5-7-9-13(12(4)14)10-11(3)8-6-2/h5,7,9,11H,4,6,8,10H2,1-3H3/b7-5-,13-9- |
| InChIKey | LTHPRRZGGPOJHX-YYKSKGJFSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|