C10H18O — CID 87292171
(E)-3,5-dimethyloct-2-enal (PubChem CID 87292171) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (E)-3,5-dimethyloct-2-enal.
| Compound Name | (E)-3,5-dimethyloct-2-enal |
|---|---|
| PubChem CID | 87292171 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (E)-3,5-dimethyloct-2-enal |
| SMILES | CCCC(C)C/C(C)=C/C=O |
| InChI | InChI=1S/C10H18O/c1-4-5-9(2)8-10(3)6-7-11/h6-7,9H,4-5,8H2,1-3H3/b10-6+ |
| InChIKey | NISVYPDXPBLLKZ-UXBLZVDNSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|