C17H30 — CID 174092506
(4E,6Z)-7-ethenyl-2,4,9-trimethyldodeca-4,6-diene (PubChem CID 174092506) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is (4E,6Z)-7-ethenyl-2,4,9-trimethyldodeca-4,6-diene.
| Compound Name | (4E,6Z)-7-ethenyl-2,4,9-trimethyldodeca-4,6-diene |
|---|---|
| PubChem CID | 174092506 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | (4E,6Z)-7-ethenyl-2,4,9-trimethyldodeca-4,6-diene |
| SMILES | C=C/C(=C\C=C(/C)CC(C)C)CC(C)CCC |
| InChI | InChI=1S/C17H30/c1-7-9-15(5)13-17(8-2)11-10-16(6)12-14(3)4/h8,10-11,14-15H,2,7,9,12-13H2,1,3-6H3/b16-10+,17-11+ |
| InChIKey | BFCUGXPLUUINNM-OTYYAQKOSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|