C12H22O2 — CID 123310821
5-methoxy-3,6-dimethylnon-2-enal (PubChem CID 123310821) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-methoxy-3,6-dimethylnon-2-enal.
| Compound Name | 5-methoxy-3,6-dimethylnon-2-enal |
|---|---|
| PubChem CID | 123310821 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 5-methoxy-3,6-dimethylnon-2-enal |
| SMILES | CCCC(C)C(CC(C)=CC=O)OC |
| InChI | InChI=1S/C12H22O2/c1-5-6-11(3)12(14-4)9-10(2)7-8-13/h7-8,11-12H,5-6,9H2,1-4H3 |
| InChIKey | GRVNKIYLDAUFBY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|