About butan-2-ol;3-methylbut-2-enal
butan-2-ol;3-methylbut-2-enal (PubChem CID 88638596) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is butan-2-ol;3-methylbut-2-enal.
Molecular Properties
| Compound Name | butan-2-ol;3-methylbut-2-enal |
| PubChem CID | 88638596 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | butan-2-ol;3-methylbut-2-enal |
| SMILES | CC(C)=CC=O.CCC(C)O |
| InChI | InChI=1S/C5H8O.C4H10O/c1-5(2)3-4-6;1-3-4(2)5/h3-4H,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | KPNZGQSKPGTIDN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;3-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;3-methylbut-2-enal?
The IUPAC name of butan-2-ol;3-methylbut-2-enal (CID 88638596) is butan-2-ol;3-methylbut-2-enal.
What is the SMILES notation for butan-2-ol;3-methylbut-2-enal?
The canonical SMILES for butan-2-ol;3-methylbut-2-enal is CC(C)=CC=O.CCC(C)O.
What is the InChIKey of butan-2-ol;3-methylbut-2-enal?
The InChIKey is KPNZGQSKPGTIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O.C4H10O/c1-5(2)3-4-6;1-3-4(2)5/h3-4H,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of butan-2-ol;3-methylbut-2-enal?
butan-2-ol;3-methylbut-2-enal has a molecular weight of 158.24 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;3-methylbut-2-enal is sourced from PubChem (CID 88638596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).