About CID 157498325
CID 157498325 (PubChem CID 157498325) has the molecular formula C4H10NaO
and a molecular weight of 97.11 g/mol.
Molecular Properties
| Compound Name | CID 157498325 |
| PubChem CID | 157498325 |
| Molecular Formula | C4H10NaO |
| Molecular Weight | 97.11 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | — |
| SMILES | CCC(C)O.[Na] |
| InChI | InChI=1S/C4H10O.Na/c1-3-4(2)5;/h4-5H,3H2,1-2H3; |
| InChIKey | BYCGYBXZYBOLMP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.11 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 157498325 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157498325?
The IUPAC name of CID 157498325 (CID 157498325) is not available.
What is the SMILES notation for CID 157498325?
The canonical SMILES for CID 157498325 is CCC(C)O.[Na].
What is the InChIKey of CID 157498325?
The InChIKey is BYCGYBXZYBOLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.Na/c1-3-4(2)5;/h4-5H,3H2,1-2H3;.
What are the key properties of CID 157498325?
CID 157498325 has a molecular weight of 97.11 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157498325 is sourced from PubChem (CID 157498325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).