About butan-2-ol;methane;pentan-3-ol
butan-2-ol;methane;pentan-3-ol (PubChem CID 160881005) has the molecular formula C11H30O2
and a molecular weight of 194.36 g/mol. Its IUPAC name is butan-2-ol;methane;pentan-3-ol.
Molecular Properties
| Compound Name | butan-2-ol;methane;pentan-3-ol |
| PubChem CID | 160881005 |
| Molecular Formula | C11H30O2 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.22 |
| IUPAC Name | butan-2-ol;methane;pentan-3-ol |
| SMILES | C.C.CCC(C)O.CCC(O)CC |
| InChI | InChI=1S/C5H12O.C4H10O.2CH4/c1-3-5(6)4-2;1-3-4(2)5;;/h5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3;2*1H4 |
| InChIKey | SNAHQQNMDBWCRU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-ol;methane;pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;methane;pentan-3-ol?
The IUPAC name of butan-2-ol;methane;pentan-3-ol (CID 160881005) is butan-2-ol;methane;pentan-3-ol.
What is the SMILES notation for butan-2-ol;methane;pentan-3-ol?
The canonical SMILES for butan-2-ol;methane;pentan-3-ol is C.C.CCC(C)O.CCC(O)CC.
What is the InChIKey of butan-2-ol;methane;pentan-3-ol?
The InChIKey is SNAHQQNMDBWCRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C4H10O.2CH4/c1-3-5(6)4-2;1-3-4(2)5;;/h5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3;2*1H4.
What are the key properties of butan-2-ol;methane;pentan-3-ol?
butan-2-ol;methane;pentan-3-ol has a molecular weight of 194.36 g/mol, XLogP of 3.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;methane;pentan-3-ol is sourced from PubChem (CID 160881005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).