About N-methylmethanamine;pentan-3-ol
N-methylmethanamine;pentan-3-ol (PubChem CID 143532118) has the molecular formula C7H19NO
and a molecular weight of 133.24 g/mol. Its IUPAC name is N-methylmethanamine;pentan-3-ol.
Molecular Properties
| Compound Name | N-methylmethanamine;pentan-3-ol |
| PubChem CID | 143532118 |
| Molecular Formula | C7H19NO |
| Molecular Weight | 133.24 g/mol |
| Exact Mass | 133.15 |
| IUPAC Name | N-methylmethanamine;pentan-3-ol |
| SMILES | CCC(O)CC.CNC |
| InChI | InChI=1S/C5H12O.C2H7N/c1-3-5(6)4-2;1-3-2/h5-6H,3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | VGMKGZZYHIJJCA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylmethanamine;pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;pentan-3-ol?
The IUPAC name of N-methylmethanamine;pentan-3-ol (CID 143532118) is N-methylmethanamine;pentan-3-ol.
What is the SMILES notation for N-methylmethanamine;pentan-3-ol?
The canonical SMILES for N-methylmethanamine;pentan-3-ol is CCC(O)CC.CNC.
What is the InChIKey of N-methylmethanamine;pentan-3-ol?
The InChIKey is VGMKGZZYHIJJCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C2H7N/c1-3-5(6)4-2;1-3-2/h5-6H,3-4H2,1-2H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;pentan-3-ol?
N-methylmethanamine;pentan-3-ol has a molecular weight of 133.24 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;pentan-3-ol is sourced from PubChem (CID 143532118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).