About butan-2-one;pentan-3-ol
butan-2-one;pentan-3-ol (PubChem CID 159181592) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is butan-2-one;pentan-3-ol.
Molecular Properties
| Compound Name | butan-2-one;pentan-3-ol |
| PubChem CID | 159181592 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | butan-2-one;pentan-3-ol |
| SMILES | CCC(C)=O.CCC(O)CC |
| InChI | InChI=1S/C5H12O.C4H8O/c1-3-5(6)4-2;1-3-4(2)5/h5-6H,3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | KMYPKVURWAEDPK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;pentan-3-ol?
The IUPAC name of butan-2-one;pentan-3-ol (CID 159181592) is butan-2-one;pentan-3-ol.
What is the SMILES notation for butan-2-one;pentan-3-ol?
The canonical SMILES for butan-2-one;pentan-3-ol is CCC(C)=O.CCC(O)CC.
What is the InChIKey of butan-2-one;pentan-3-ol?
The InChIKey is KMYPKVURWAEDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C4H8O/c1-3-5(6)4-2;1-3-4(2)5/h5-6H,3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of butan-2-one;pentan-3-ol?
butan-2-one;pentan-3-ol has a molecular weight of 160.26 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;pentan-3-ol is sourced from PubChem (CID 159181592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).