About (4R,6R)-4,6-dihydroxyoctan-2-one
(4R,6R)-4,6-dihydroxyoctan-2-one (PubChem CID 58846635) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is (4R,6R)-4,6-dihydroxyoctan-2-one.
Molecular Properties
| Compound Name | (4R,6R)-4,6-dihydroxyoctan-2-one |
| PubChem CID | 58846635 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (4R,6R)-4,6-dihydroxyoctan-2-one |
| SMILES | CC[C@@H](O)C[C@@H](O)CC(C)=O |
| InChI | InChI=1S/C8H16O3/c1-3-7(10)5-8(11)4-6(2)9/h7-8,10-11H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | AIUFQJWTKTWLQS-SFYZADRCSA-N |
| XLogP | 0.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,6R)-4,6-dihydroxyoctan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6R)-4,6-dihydroxyoctan-2-one?
The IUPAC name of (4R,6R)-4,6-dihydroxyoctan-2-one (CID 58846635) is (4R,6R)-4,6-dihydroxyoctan-2-one.
What is the SMILES notation for (4R,6R)-4,6-dihydroxyoctan-2-one?
The canonical SMILES for (4R,6R)-4,6-dihydroxyoctan-2-one is CC[C@@H](O)C[C@@H](O)CC(C)=O.
What is the InChIKey of (4R,6R)-4,6-dihydroxyoctan-2-one?
The InChIKey is AIUFQJWTKTWLQS-SFYZADRCSA-N. The full InChI is InChI=1S/C8H16O3/c1-3-7(10)5-8(11)4-6(2)9/h7-8,10-11H,3-5H2,1-2H3/t7-,8+/m1/s1.
What are the key properties of (4R,6R)-4,6-dihydroxyoctan-2-one?
(4R,6R)-4,6-dihydroxyoctan-2-one has a molecular weight of 160.21 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6R)-4,6-dihydroxyoctan-2-one is sourced from PubChem (CID 58846635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).