C10H20O — CID 15199451
(4R,6R)-4,6-dimethyloctan-2-one (PubChem CID 15199451) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (4R,6R)-4,6-dimethyloctan-2-one.
| Compound Name | (4R,6R)-4,6-dimethyloctan-2-one |
|---|---|
| PubChem CID | 15199451 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (4R,6R)-4,6-dimethyloctan-2-one |
| SMILES | CC[C@@H](C)C[C@@H](C)CC(C)=O |
| InChI | InChI=1S/C10H20O/c1-5-8(2)6-9(3)7-10(4)11/h8-9H,5-7H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | NMSDKCQPRHCSMG-RKDXNWHRSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |