C11H22O — CID 87291820
4,7-dimethylnonan-2-one (PubChem CID 87291820) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 4,7-dimethylnonan-2-one.
| Compound Name | 4,7-dimethylnonan-2-one |
|---|---|
| PubChem CID | 87291820 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 4,7-dimethylnonan-2-one |
| SMILES | CCC(C)CCC(C)CC(C)=O |
| InChI | InChI=1S/C11H22O/c1-5-9(2)6-7-10(3)8-11(4)12/h9-10H,5-8H2,1-4H3 |
| InChIKey | APUGNZZIIKJBAR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |