About (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one
(4R)-4-hydroxyhexan-2-one;propanal;propan-2-one (PubChem CID 158804070) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one.
Molecular Properties
| Compound Name | (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one |
| PubChem CID | 158804070 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one |
| SMILES | CC(C)=O.CCC=O.CC[C@@H](O)CC(C)=O |
| InChI | InChI=1S/C6H12O2.2C3H6O/c1-3-6(8)4-5(2)7;1-3(2)4;1-2-3-4/h6,8H,3-4H2,1-2H3;1-2H3;3H,2H2,1H3/t6-;;/m1../s1 |
| InChIKey | ITVRWHXKQHRXCC-QYCVXMPOSA-N |
| XLogP | 1.93 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one?
The IUPAC name of (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one (CID 158804070) is (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one.
What is the SMILES notation for (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one?
The canonical SMILES for (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one is CC(C)=O.CCC=O.CC[C@@H](O)CC(C)=O.
What is the InChIKey of (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one?
The InChIKey is ITVRWHXKQHRXCC-QYCVXMPOSA-N. The full InChI is InChI=1S/C6H12O2.2C3H6O/c1-3-6(8)4-5(2)7;1-3(2)4;1-2-3-4/h6,8H,3-4H2,1-2H3;1-2H3;3H,2H2,1H3/t6-;;/m1../s1.
What are the key properties of (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one?
(4R)-4-hydroxyhexan-2-one;propanal;propan-2-one has a molecular weight of 232.32 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxyhexan-2-one;propanal;propan-2-one is sourced from PubChem (CID 158804070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).