About 3-hydroxypentanal;methanamine
3-hydroxypentanal;methanamine (PubChem CID 174648159) has the molecular formula C8H25N3O2
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-hydroxypentanal;methanamine.
Molecular Properties
| Compound Name | 3-hydroxypentanal;methanamine |
| PubChem CID | 174648159 |
| Molecular Formula | C8H25N3O2 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | 3-hydroxypentanal;methanamine |
| SMILES | CCC(O)CC=O.CN.CN.CN |
| InChI | InChI=1S/C5H10O2.3CH5N/c1-2-5(7)3-4-6;3*1-2/h4-5,7H,2-3H2,1H3;3*2H2,1H3 |
| InChIKey | YXUXULWRUDUBNY-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypentanal;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypentanal;methanamine?
The IUPAC name of 3-hydroxypentanal;methanamine (CID 174648159) is 3-hydroxypentanal;methanamine.
What is the SMILES notation for 3-hydroxypentanal;methanamine?
The canonical SMILES for 3-hydroxypentanal;methanamine is CCC(O)CC=O.CN.CN.CN.
What is the InChIKey of 3-hydroxypentanal;methanamine?
The InChIKey is YXUXULWRUDUBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.3CH5N/c1-2-5(7)3-4-6;3*1-2/h4-5,7H,2-3H2,1H3;3*2H2,1H3.
What are the key properties of 3-hydroxypentanal;methanamine?
3-hydroxypentanal;methanamine has a molecular weight of 195.31 g/mol, XLogP of -0.93, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypentanal;methanamine is sourced from PubChem (CID 174648159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).