About 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal
2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal (PubChem CID 87928831) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal |
| PubChem CID | 87928831 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal |
| SMILES | CCC(C)(C=O)CO.CCC(O)CC=O |
| InChI | InChI=1S/C6H12O2.C5H10O2/c1-3-6(2,4-7)5-8;1-2-5(7)3-4-6/h4,8H,3,5H2,1-2H3;4-5,7H,2-3H2,1H3 |
| InChIKey | ZKFGDTHYEKZDBO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal?
The IUPAC name of 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal (CID 87928831) is 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal.
What is the SMILES notation for 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal?
The canonical SMILES for 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal is CCC(C)(C=O)CO.CCC(O)CC=O.
What is the InChIKey of 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal?
The InChIKey is ZKFGDTHYEKZDBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C5H10O2/c1-3-6(2,4-7)5-8;1-2-5(7)3-4-6/h4,8H,3,5H2,1-2H3;4-5,7H,2-3H2,1H3.
What are the key properties of 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal?
2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal has a molecular weight of 218.29 g/mol, XLogP of 0.94, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-methylbutanal;3-hydroxypentanal is sourced from PubChem (CID 87928831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).