About ethyl 2-hydroxy-4-oxobutanoate
ethyl 2-hydroxy-4-oxobutanoate (PubChem CID 78382664) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-4-oxobutanoate |
| PubChem CID | 78382664 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | ethyl 2-hydroxy-4-oxobutanoate |
| SMILES | CCOC(=O)C(O)CC=O |
| InChI | InChI=1S/C6H10O4/c1-2-10-6(9)5(8)3-4-7/h4-5,8H,2-3H2,1H3 |
| InChIKey | PFOGDPPCAZBSPD-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxy-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-4-oxobutanoate?
The IUPAC name of ethyl 2-hydroxy-4-oxobutanoate (CID 78382664) is ethyl 2-hydroxy-4-oxobutanoate.
What is the SMILES notation for ethyl 2-hydroxy-4-oxobutanoate?
The canonical SMILES for ethyl 2-hydroxy-4-oxobutanoate is CCOC(=O)C(O)CC=O.
What is the InChIKey of ethyl 2-hydroxy-4-oxobutanoate?
The InChIKey is PFOGDPPCAZBSPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-2-10-6(9)5(8)3-4-7/h4-5,8H,2-3H2,1H3.
What are the key properties of ethyl 2-hydroxy-4-oxobutanoate?
ethyl 2-hydroxy-4-oxobutanoate has a molecular weight of 146.14 g/mol, XLogP of -0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-4-oxobutanoate is sourced from PubChem (CID 78382664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).