About diethyl 2-hydroxybutanedioate;diethyl propanedioate
diethyl 2-hydroxybutanedioate;diethyl propanedioate (PubChem CID 174923020) has the molecular formula C15H26O9
and a molecular weight of 350.36 g/mol. Its IUPAC name is diethyl 2-hydroxybutanedioate;diethyl propanedioate.
Molecular Properties
| Compound Name | diethyl 2-hydroxybutanedioate;diethyl propanedioate |
| PubChem CID | 174923020 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | diethyl 2-hydroxybutanedioate;diethyl propanedioate |
| SMILES | CCOC(=O)CC(=O)OCC.CCOC(=O)CC(O)C(=O)OCC |
| InChI | InChI=1S/C8H14O5.C7H12O4/c1-3-12-7(10)5-6(9)8(11)13-4-2;1-3-10-6(8)5-7(9)11-4-2/h6,9H,3-5H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | CORJFVXDTMZUHR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-hydroxybutanedioate;diethyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-hydroxybutanedioate;diethyl propanedioate?
The IUPAC name of diethyl 2-hydroxybutanedioate;diethyl propanedioate (CID 174923020) is diethyl 2-hydroxybutanedioate;diethyl propanedioate.
What is the SMILES notation for diethyl 2-hydroxybutanedioate;diethyl propanedioate?
The canonical SMILES for diethyl 2-hydroxybutanedioate;diethyl propanedioate is CCOC(=O)CC(=O)OCC.CCOC(=O)CC(O)C(=O)OCC.
What is the InChIKey of diethyl 2-hydroxybutanedioate;diethyl propanedioate?
The InChIKey is CORJFVXDTMZUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5.C7H12O4/c1-3-12-7(10)5-6(9)8(11)13-4-2;1-3-10-6(8)5-7(9)11-4-2/h6,9H,3-5H2,1-2H3;3-5H2,1-2H3.
What are the key properties of diethyl 2-hydroxybutanedioate;diethyl propanedioate?
diethyl 2-hydroxybutanedioate;diethyl propanedioate has a molecular weight of 350.36 g/mol, XLogP of 0.37, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-hydroxybutanedioate;diethyl propanedioate is sourced from PubChem (CID 174923020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).