About ethyl 2-hydroxybutanoate
ethyl 2-hydroxybutanoate (PubChem CID 521365) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is ethyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | ethyl 2-hydroxybutanoate |
| PubChem CID | 521365 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | ethyl 2-hydroxybutanoate |
| SMILES | CCOC(=O)C(O)CC |
| InChI | InChI=1S/C6H12O3/c1-3-5(7)6(8)9-4-2/h5,7H,3-4H2,1-2H3 |
| InChIKey | KWWOQRSLYPHAMK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxybutanoate?
The IUPAC name of ethyl 2-hydroxybutanoate (CID 521365) is ethyl 2-hydroxybutanoate.
What is the SMILES notation for ethyl 2-hydroxybutanoate?
The canonical SMILES for ethyl 2-hydroxybutanoate is CCOC(=O)C(O)CC.
What is the InChIKey of ethyl 2-hydroxybutanoate?
The InChIKey is KWWOQRSLYPHAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c1-3-5(7)6(8)9-4-2/h5,7H,3-4H2,1-2H3.
What are the key properties of ethyl 2-hydroxybutanoate?
ethyl 2-hydroxybutanoate has a molecular weight of 132.16 g/mol, XLogP of 0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxybutanoate is sourced from PubChem (CID 521365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).