About ethyl carbamate;2-hydroxybutanoic acid
ethyl carbamate;2-hydroxybutanoic acid (PubChem CID 118110329) has the molecular formula C7H15NO5
and a molecular weight of 193.20 g/mol. Its IUPAC name is ethyl carbamate;2-hydroxybutanoic acid.
Molecular Properties
| Compound Name | ethyl carbamate;2-hydroxybutanoic acid |
| PubChem CID | 118110329 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | ethyl carbamate;2-hydroxybutanoic acid |
| SMILES | CCC(O)C(=O)O.CCOC(N)=O |
| InChI | InChI=1S/C4H8O3.C3H7NO2/c1-2-3(5)4(6)7;1-2-6-3(4)5/h3,5H,2H2,1H3,(H,6,7);2H2,1H3,(H2,4,5) |
| InChIKey | QUNKPFPJCOSNAC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl carbamate;2-hydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbamate;2-hydroxybutanoic acid?
The IUPAC name of ethyl carbamate;2-hydroxybutanoic acid (CID 118110329) is ethyl carbamate;2-hydroxybutanoic acid.
What is the SMILES notation for ethyl carbamate;2-hydroxybutanoic acid?
The canonical SMILES for ethyl carbamate;2-hydroxybutanoic acid is CCC(O)C(=O)O.CCOC(N)=O.
What is the InChIKey of ethyl carbamate;2-hydroxybutanoic acid?
The InChIKey is QUNKPFPJCOSNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C3H7NO2/c1-2-3(5)4(6)7;1-2-6-3(4)5/h3,5H,2H2,1H3,(H,6,7);2H2,1H3,(H2,4,5).
What are the key properties of ethyl carbamate;2-hydroxybutanoic acid?
ethyl carbamate;2-hydroxybutanoic acid has a molecular weight of 193.20 g/mol, XLogP of -0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;2-hydroxybutanoic acid is sourced from PubChem (CID 118110329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).