About 3-hydroxypentanamide;hydrochloride
3-hydroxypentanamide;hydrochloride (PubChem CID 174591125) has the molecular formula C5H12ClNO2
and a molecular weight of 153.61 g/mol. Its IUPAC name is 3-hydroxypentanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-hydroxypentanamide;hydrochloride |
| PubChem CID | 174591125 |
| Molecular Formula | C5H12ClNO2 |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 3-hydroxypentanamide;hydrochloride |
| SMILES | CCC(O)CC(N)=O.Cl |
| InChI | InChI=1S/C5H11NO2.ClH/c1-2-4(7)3-5(6)8;/h4,7H,2-3H2,1H3,(H2,6,8);1H |
| InChIKey | LQKXKNFSKINWOU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxypentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypentanamide;hydrochloride?
The IUPAC name of 3-hydroxypentanamide;hydrochloride (CID 174591125) is 3-hydroxypentanamide;hydrochloride.
What is the SMILES notation for 3-hydroxypentanamide;hydrochloride?
The canonical SMILES for 3-hydroxypentanamide;hydrochloride is CCC(O)CC(N)=O.Cl.
What is the InChIKey of 3-hydroxypentanamide;hydrochloride?
The InChIKey is LQKXKNFSKINWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.ClH/c1-2-4(7)3-5(6)8;/h4,7H,2-3H2,1H3,(H2,6,8);1H.
What are the key properties of 3-hydroxypentanamide;hydrochloride?
3-hydroxypentanamide;hydrochloride has a molecular weight of 153.61 g/mol, XLogP of 0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypentanamide;hydrochloride is sourced from PubChem (CID 174591125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).