C5H11NO3 — CID 90721259
3,5-dihydroxypentanamide (PubChem CID 90721259) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 3,5-dihydroxypentanamide.
| Compound Name | 3,5-dihydroxypentanamide |
|---|---|
| PubChem CID | 90721259 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 3,5-dihydroxypentanamide |
| SMILES | NC(=O)CC(O)CCO |
| InChI | InChI=1S/C5H11NO3/c6-5(9)3-4(8)1-2-7/h4,7-8H,1-3H2,(H2,6,9) |
| InChIKey | GYDMKRHLTDSSJQ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |