C7H18N2O3 — CID 15630699
(4-amino-2-hydroxy-4-oxobutyl)-trimethylazanium hydroxide (PubChem CID 15630699) has the molecular formula C7H18N2O3 and a molecular weight of 178.23 g/mol. Its IUPAC name is (4-amino-2-hydroxy-4-oxobutyl)-trimethylazanium hydroxide.
| Compound Name | (4-amino-2-hydroxy-4-oxobutyl)-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 15630699 |
| Molecular Formula | C7H18N2O3 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | (4-amino-2-hydroxy-4-oxobutyl)-trimethylazanium hydroxide |
| SMILES | C[N+](C)(C)CC(O)CC(N)=O.[OH-] |
| InChI | InChI=1S/C7H16N2O2.H2O/c1-9(2,3)5-6(10)4-7(8)11;/h6,10H,4-5H2,1-3H3,(H-,8,11);1H2 |
| InChIKey | CVKLISVCMHPWKX-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|