About 3-methylbutanamide
3-methylbutanamide (PubChem CID 87933309) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-methylbutanamide.
Molecular Properties
| Compound Name | 3-methylbutanamide |
| PubChem CID | 87933309 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-methylbutanamide |
| SMILES | CC(C)CC(N)=O.CC(C)CC(N)=O |
| InChI | InChI=1S/2C5H11NO/c2*1-4(2)3-5(6)7/h2*4H,3H2,1-2H3,(H2,6,7) |
| InChIKey | JOMXMHVFDNYEHI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanamide?
The IUPAC name of 3-methylbutanamide (CID 87933309) is 3-methylbutanamide.
What is the SMILES notation for 3-methylbutanamide?
The canonical SMILES for 3-methylbutanamide is CC(C)CC(N)=O.CC(C)CC(N)=O.
What is the InChIKey of 3-methylbutanamide?
The InChIKey is JOMXMHVFDNYEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO/c2*1-4(2)3-5(6)7/h2*4H,3H2,1-2H3,(H2,6,7).
What are the key properties of 3-methylbutanamide?
3-methylbutanamide has a molecular weight of 202.30 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanamide is sourced from PubChem (CID 87933309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).