About 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide
3-methoxy-3-methylbutan-1-ol;3-methylbutanamide (PubChem CID 170646143) has the molecular formula C11H25NO3
and a molecular weight of 219.32 g/mol. Its IUPAC name is 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide.
Molecular Properties
| Compound Name | 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide |
| PubChem CID | 170646143 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide |
| SMILES | CC(C)CC(N)=O.COC(C)(C)CCO |
| InChI | InChI=1S/C6H14O2.C5H11NO/c1-6(2,8-3)4-5-7;1-4(2)3-5(6)7/h7H,4-5H2,1-3H3;4H,3H2,1-2H3,(H2,6,7) |
| InChIKey | UWPPYGBNHLSOBD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide?
The IUPAC name of 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide (CID 170646143) is 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide.
What is the SMILES notation for 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide?
The canonical SMILES for 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide is CC(C)CC(N)=O.COC(C)(C)CCO.
What is the InChIKey of 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide?
The InChIKey is UWPPYGBNHLSOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C5H11NO/c1-6(2,8-3)4-5-7;1-4(2)3-5(6)7/h7H,4-5H2,1-3H3;4H,3H2,1-2H3,(H2,6,7).
What are the key properties of 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide?
3-methoxy-3-methylbutan-1-ol;3-methylbutanamide has a molecular weight of 219.32 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-3-methylbutan-1-ol;3-methylbutanamide is sourced from PubChem (CID 170646143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).