About 3-methylbutanamide;propanal
3-methylbutanamide;propanal (PubChem CID 145275365) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-methylbutanamide;propanal.
Molecular Properties
| Compound Name | 3-methylbutanamide;propanal |
| PubChem CID | 145275365 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3-methylbutanamide;propanal |
| SMILES | CC(C)CC(N)=O.CCC=O |
| InChI | InChI=1S/C5H11NO.C3H6O/c1-4(2)3-5(6)7;1-2-3-4/h4H,3H2,1-2H3,(H2,6,7);3H,2H2,1H3 |
| InChIKey | WWJMSLDEMJHBEJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanamide;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanamide;propanal?
The IUPAC name of 3-methylbutanamide;propanal (CID 145275365) is 3-methylbutanamide;propanal.
What is the SMILES notation for 3-methylbutanamide;propanal?
The canonical SMILES for 3-methylbutanamide;propanal is CC(C)CC(N)=O.CCC=O.
What is the InChIKey of 3-methylbutanamide;propanal?
The InChIKey is WWJMSLDEMJHBEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C3H6O/c1-4(2)3-5(6)7;1-2-3-4/h4H,3H2,1-2H3,(H2,6,7);3H,2H2,1H3.
What are the key properties of 3-methylbutanamide;propanal?
3-methylbutanamide;propanal has a molecular weight of 159.23 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanamide;propanal is sourced from PubChem (CID 145275365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).