C8H17NO2 — CID 89154230
3-hydroxy-4,5-dimethylhexanamide (PubChem CID 89154230) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-hydroxy-4,5-dimethylhexanamide.
| Compound Name | 3-hydroxy-4,5-dimethylhexanamide |
|---|---|
| PubChem CID | 89154230 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3-hydroxy-4,5-dimethylhexanamide |
| SMILES | CC(C)C(C)C(O)CC(N)=O |
| InChI | InChI=1S/C8H17NO2/c1-5(2)6(3)7(10)4-8(9)11/h5-7,10H,4H2,1-3H3,(H2,9,11) |
| InChIKey | DESPVUHIQNZDDP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |