C6H11NO3 — CID 121479436
(3S,4S)-3-hydroxy-4-methyl-5-oxopentanamide (PubChem CID 121479436) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is (3S,4S)-3-hydroxy-4-methyl-5-oxopentanamide.
| Compound Name | (3S,4S)-3-hydroxy-4-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 121479436 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (3S,4S)-3-hydroxy-4-methyl-5-oxopentanamide |
| SMILES | C[C@H](C=O)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C6H11NO3/c1-4(3-8)5(9)2-6(7)10/h3-5,9H,2H2,1H3,(H2,7,10)/t4-,5+/m1/s1 |
| InChIKey | FLYXWWJKVXGFBP-UHNVWZDZSA-N |
| XLogP | -0.94 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|