C12H22N2O3 — CID 118882685
(E,3S,4R)-3-hydroxy-4-methyl-7-morpholin-4-ylhept-5-enamide (PubChem CID 118882685) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (E,3S,4R)-3-hydroxy-4-methyl-7-morpholin-4-ylhept-5-enamide.
| Compound Name | (E,3S,4R)-3-hydroxy-4-methyl-7-morpholin-4-ylhept-5-enamide |
|---|---|
| PubChem CID | 118882685 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (E,3S,4R)-3-hydroxy-4-methyl-7-morpholin-4-ylhept-5-enamide |
| SMILES | C[C@H](/C=C/CN1CCOCC1)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C12H22N2O3/c1-10(11(15)9-12(13)16)3-2-4-14-5-7-17-8-6-14/h2-3,10-11,15H,4-9H2,1H3,(H2,13,16)/b3-2+/t10-,11+/m1/s1 |
| InChIKey | KMDBOSRSMXBXAH-NTYHVHHESA-N |
| XLogP | -0.25 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|