C12H24N2O3 — CID 118882622
(3S,4R)-3-hydroxy-4-methyl-6-(1,4-oxazepan-4-yl)hexanamide (PubChem CID 118882622) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4-methyl-6-(1,4-oxazepan-4-yl)hexanamide.
| Compound Name | (3S,4R)-3-hydroxy-4-methyl-6-(1,4-oxazepan-4-yl)hexanamide |
|---|---|
| PubChem CID | 118882622 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3S,4R)-3-hydroxy-4-methyl-6-(1,4-oxazepan-4-yl)hexanamide |
| SMILES | C[C@H](CCN1CCCOCC1)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C12H24N2O3/c1-10(11(15)9-12(13)16)3-5-14-4-2-7-17-8-6-14/h10-11,15H,2-9H2,1H3,(H2,13,16)/t10-,11+/m1/s1 |
| InChIKey | OIPDIPLVOYSXDV-MNOVXSKESA-N |
| XLogP | -0.03 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |