C12H24N2O3 — CID 55142794
4-(1,4-oxazepan-4-yl)-2-(propylamino)butanoic acid (PubChem CID 55142794) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-(1,4-oxazepan-4-yl)-2-(propylamino)butanoic acid.
| Compound Name | 4-(1,4-oxazepan-4-yl)-2-(propylamino)butanoic acid |
|---|---|
| PubChem CID | 55142794 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4-(1,4-oxazepan-4-yl)-2-(propylamino)butanoic acid |
| SMILES | CCCNC(CCN1CCCOCC1)C(=O)O |
| InChI | InChI=1S/C12H24N2O3/c1-2-5-13-11(12(15)16)4-7-14-6-3-9-17-10-8-14/h11,13H,2-10H2,1H3,(H,15,16) |
| InChIKey | ZSASTBLIQKFJAR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |