C11H22N2O3S — CID 55144124
4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid (PubChem CID 55144124) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid.
| Compound Name | 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid |
|---|---|
| PubChem CID | 55144124 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid |
| SMILES | CCCNC(CCN1CCS(=O)CC1)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-2-4-12-10(11(14)15)3-5-13-6-8-17(16)9-7-13/h10,12H,2-9H2,1H3,(H,14,15) |
| InChIKey | PIQCAFQIZRHWPM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |