4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid

C11H22N2O3S — CID 55144124

IUPAC4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid
SMILESCCCNC(CCN1CCS(=O)CC1)C(=O)O
InChIInChI=1S/C11H22N2O3S/c1-2-4-12-10(11(14)15)3-5-13-6-8-17(16)9-7-13/h10,12H,2-9H2,1H3,(H,14,15)
InChIKeyPIQCAFQIZRHWPM-UHFFFAOYSA-N
MW262.37 g/mol
LogP-0.11
Rot. Bonds7

About 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid

4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid (PubChem CID 55144124) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid.

Molecular Properties

Compound Name4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid
PubChem CID55144124
Molecular FormulaC11H22N2O3S
Molecular Weight262.37 g/mol
Exact Mass262.14
IUPAC Name4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid
SMILESCCCNC(CCN1CCS(=O)CC1)C(=O)O
InChIInChI=1S/C11H22N2O3S/c1-2-4-12-10(11(14)15)3-5-13-6-8-17(16)9-7-13/h10,12H,2-9H2,1H3,(H,14,15)
InChIKeyPIQCAFQIZRHWPM-UHFFFAOYSA-N
XLogP-0.11
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.37
LogP ≤ 5-0.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid?
The IUPAC name of 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid (CID 55144124) is 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid.
What is the SMILES notation for 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid?
The canonical SMILES for 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid is CCCNC(CCN1CCS(=O)CC1)C(=O)O.
What is the InChIKey of 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid?
The InChIKey is PIQCAFQIZRHWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S/c1-2-4-12-10(11(14)15)3-5-13-6-8-17(16)9-7-13/h10,12H,2-9H2,1H3,(H,14,15).
What are the key properties of 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid?
4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid has a molecular weight of 262.37 g/mol, XLogP of -0.11, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoic acid is sourced from PubChem (CID 55144124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).