About methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate
methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate (PubChem CID 55145293) has the molecular formula C15H30N2O2
and a molecular weight of 270.42 g/mol. Its IUPAC name is methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate.
Analyze methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate?
The IUPAC name of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate (CID 55145293) is methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate.
What is the SMILES notation for methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate?
The canonical SMILES for methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate is CCCNC(CCN1CCC(C)(C)CC1)C(=O)OC.
What is the InChIKey of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate?
The InChIKey is FHFOEZNVZQREPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2/c1-5-9-16-13(14(18)19-4)6-10-17-11-7-15(2,3)8-12-17/h13,16H,5-12H2,1-4H3.
What are the key properties of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate?
methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate has a molecular weight of 270.42 g/mol, XLogP of 2.04, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(propylamino)butanoate is sourced from PubChem (CID 55145293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).