About methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate
methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate (PubChem CID 63055247) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate.
Molecular Properties
| Compound Name | methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate |
| PubChem CID | 63055247 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate |
| SMILES | CCNC(CCN1CCC(C)(C)CC1)C(=O)OC |
| InChI | InChI=1S/C14H28N2O2/c1-5-15-12(13(17)18-4)6-9-16-10-7-14(2,3)8-11-16/h12,15H,5-11H2,1-4H3 |
| InChIKey | SMKQEXWXZPZTJC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate?
The IUPAC name of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate (CID 63055247) is methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate.
What is the SMILES notation for methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate?
The canonical SMILES for methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate is CCNC(CCN1CCC(C)(C)CC1)C(=O)OC.
What is the InChIKey of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate?
The InChIKey is SMKQEXWXZPZTJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-5-15-12(13(17)18-4)6-9-16-10-7-14(2,3)8-11-16/h12,15H,5-11H2,1-4H3.
What are the key properties of methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate?
methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate has a molecular weight of 256.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butanoate is sourced from PubChem (CID 63055247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).