About 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol
4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol (PubChem CID 64791854) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol.
Molecular Properties
| Compound Name | 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol |
| PubChem CID | 64791854 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol |
| SMILES | CCNC(CO)CCN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H28N2O/c1-4-14-12(11-16)5-8-15-9-6-13(2,3)7-10-15/h12,14,16H,4-11H2,1-3H3 |
| InChIKey | WDZUVAJHVSOICH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol?
The IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol (CID 64791854) is 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol.
What is the SMILES notation for 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol?
The canonical SMILES for 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol is CCNC(CO)CCN1CCC(C)(C)CC1.
What is the InChIKey of 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol?
The InChIKey is WDZUVAJHVSOICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-4-14-12(11-16)5-8-15-9-6-13(2,3)7-10-15/h12,14,16H,4-11H2,1-3H3.
What are the key properties of 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol?
4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol has a molecular weight of 228.38 g/mol, XLogP of 1.47, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)butan-1-ol is sourced from PubChem (CID 64791854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).