methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate

C12H24N2O3S — CID 55144311

IUPACmethyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate
SMILESCCCNC(CCN1CCS(=O)CC1)C(=O)OC
InChIInChI=1S/C12H24N2O3S/c1-3-5-13-11(12(15)17-2)4-6-14-7-9-18(16)10-8-14/h11,13H,3-10H2,1-2H3
InChIKeyFMNHSIVIFPVMBE-UHFFFAOYSA-N
MW276.40 g/mol
LogP-0.02
Rot. Bonds7

About methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate

methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate (PubChem CID 55144311) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate.

Molecular Properties

Compound Namemethyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate
PubChem CID55144311
Molecular FormulaC12H24N2O3S
Molecular Weight276.40 g/mol
Exact Mass276.15
IUPAC Namemethyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate
SMILESCCCNC(CCN1CCS(=O)CC1)C(=O)OC
InChIInChI=1S/C12H24N2O3S/c1-3-5-13-11(12(15)17-2)4-6-14-7-9-18(16)10-8-14/h11,13H,3-10H2,1-2H3
InChIKeyFMNHSIVIFPVMBE-UHFFFAOYSA-N
XLogP-0.02
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.40
LogP ≤ 5-0.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate?
The IUPAC name of methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate (CID 55144311) is methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate.
What is the SMILES notation for methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate?
The canonical SMILES for methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate is CCCNC(CCN1CCS(=O)CC1)C(=O)OC.
What is the InChIKey of methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate?
The InChIKey is FMNHSIVIFPVMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3S/c1-3-5-13-11(12(15)17-2)4-6-14-7-9-18(16)10-8-14/h11,13H,3-10H2,1-2H3.
What are the key properties of methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate?
methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate has a molecular weight of 276.40 g/mol, XLogP of -0.02, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-oxo-1,4-thiazinan-4-yl)-2-(propylamino)butanoate is sourced from PubChem (CID 55144311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).