C17H27ClN2O — CID 62972105
1-(4-chlorophenyl)-3-(1,4-oxazepan-4-yl)-N-propylpropan-1-amine (PubChem CID 62972105) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(1,4-oxazepan-4-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-3-(1,4-oxazepan-4-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 62972105 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(1,4-oxazepan-4-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCN1CCCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H27ClN2O/c1-2-9-19-17(15-4-6-16(18)7-5-15)8-11-20-10-3-13-21-14-12-20/h4-7,17,19H,2-3,8-14H2,1H3 |
| InChIKey | KYCFCHVHMCRZFG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |