C14H21ClN2 — CID 2757853
1-(4-chlorophenyl)-N-methyl-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 2757853) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-methyl-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-N-methyl-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 2757853 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N-methyl-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | CNC(CCN1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2/c1-16-14(8-11-17-9-2-3-10-17)12-4-6-13(15)7-5-12/h4-7,14,16H,2-3,8-11H2,1H3 |
| InChIKey | HTBYEDLGYDDTFB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |