C25H43N3O3 — CID 159904343
(E)-6-(4-cyclopropylpiperazin-1-yl)-2-methylhex-4-en-3-one;(E)-2-methyl-6-morpholin-4-ylhex-4-en-3-one (PubChem CID 159904343) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is (E)-6-(4-cyclopropylpiperazin-1-yl)-2-methylhex-4-en-3-one;(E)-2-methyl-6-morpholin-4-ylhex-4-en-3-one.
| Compound Name | (E)-6-(4-cyclopropylpiperazin-1-yl)-2-methylhex-4-en-3-one;(E)-2-methyl-6-morpholin-4-ylhex-4-en-3-one |
|---|---|
| PubChem CID | 159904343 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | (E)-6-(4-cyclopropylpiperazin-1-yl)-2-methylhex-4-en-3-one;(E)-2-methyl-6-morpholin-4-ylhex-4-en-3-one |
| SMILES | CC(C)C(=O)/C=C/CN1CCN(C2CC2)CC1.CC(C)C(=O)/C=C/CN1CCOCC1 |
| InChI | InChI=1S/C14H24N2O.C11H19NO2/c1-12(2)14(17)4-3-7-15-8-10-16(11-9-15)13-5-6-13;1-10(2)11(13)4-3-5-12-6-8-14-9-7-12/h3-4,12-13H,5-11H2,1-2H3;3-4,10H,5-9H2,1-2H3/b2*4-3+ |
| InChIKey | NWJGONRHOIOGFJ-XOMXBQTJSA-N |
| XLogP | 2.65 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|