C15H27N3O2 — CID 167185991
(E)-4-morpholin-4-yl-1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]but-2-en-1-one (PubChem CID 167185991) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is (E)-4-morpholin-4-yl-1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-morpholin-4-yl-1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 167185991 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (E)-4-morpholin-4-yl-1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]but-2-en-1-one |
| SMILES | C[C@@H]1CN(C)[C@@H](C)CN1C(=O)/C=C/CN1CCOCC1 |
| InChI | InChI=1S/C15H27N3O2/c1-13-12-18(14(2)11-16(13)3)15(19)5-4-6-17-7-9-20-10-8-17/h4-5,13-14H,6-12H2,1-3H3/b5-4+/t13-,14+/m0/s1 |
| InChIKey | LPIWZEHGLOCEPE-OOPLNXAUSA-N |
| XLogP | 0.43 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|