C14H24IN3O2 — CID 167185714
(E)-1-(4-iodo-2,5-dimethylpiperazin-1-yl)-4-morpholin-4-ylbut-2-en-1-one (PubChem CID 167185714) has the molecular formula C14H24IN3O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is (E)-1-(4-iodo-2,5-dimethylpiperazin-1-yl)-4-morpholin-4-ylbut-2-en-1-one.
| Compound Name | (E)-1-(4-iodo-2,5-dimethylpiperazin-1-yl)-4-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 167185714 |
| Molecular Formula | C14H24IN3O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (E)-1-(4-iodo-2,5-dimethylpiperazin-1-yl)-4-morpholin-4-ylbut-2-en-1-one |
| SMILES | CC1CN(C(=O)/C=C/CN2CCOCC2)C(C)CN1I |
| InChI | InChI=1S/C14H24IN3O2/c1-12-11-18(15)13(2)10-17(12)14(19)4-3-5-16-6-8-20-9-7-16/h3-4,12-13H,5-11H2,1-2H3/b4-3+ |
| InChIKey | YAZZHGUKWQCJNC-ONEGZZNKSA-N |
| XLogP | 1.15 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|