C16H28N4O2 — CID 163658437
(E)-1-[(3R)-3-[ethyl-(methylideneamino)amino]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one (PubChem CID 163658437) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[ethyl-(methylideneamino)amino]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[ethyl-(methylideneamino)amino]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 163658437 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (E)-1-[(3R)-3-[ethyl-(methylideneamino)amino]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one |
| SMILES | C=NN(CC)[C@@H]1CCCN(C(=O)/C=C/CN2CCOCC2)C1 |
| InChI | InChI=1S/C16H28N4O2/c1-3-20(17-2)15-6-4-9-19(14-15)16(21)7-5-8-18-10-12-22-13-11-18/h5,7,15H,2-4,6,8-14H2,1H3/b7-5+/t15-/m1/s1 |
| InChIKey | ISGKAZDCVJJJIM-KEDPEKRHSA-N |
| XLogP | 0.80 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|