C24H32N6O3 — CID 154195621
5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-(4-morpholin-4-ylbut-2-enoyl)piperidin-3-yl]amino]-1H-pyridin-2-one (PubChem CID 154195621) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-(4-morpholin-4-ylbut-2-enoyl)piperidin-3-yl]amino]-1H-pyridin-2-one.
| Compound Name | 5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-(4-morpholin-4-ylbut-2-enoyl)piperidin-3-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 154195621 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-(4-morpholin-4-ylbut-2-enoyl)piperidin-3-yl]amino]-1H-pyridin-2-one |
| SMILES | CNc1cc(-c2c[nH]c(=O)c(N[C@@H]3CCCN(C(=O)C=CCN4CCOCC4)C3)c2)ccn1 |
| InChI | InChI=1S/C24H32N6O3/c1-25-22-15-18(6-7-26-22)19-14-21(24(32)27-16-19)28-20-4-2-9-30(17-20)23(31)5-3-8-29-10-12-33-13-11-29/h3,5-7,14-16,20,28H,2,4,8-13,17H2,1H3,(H,25,26)(H,27,32)/t20-/m1/s1 |
| InChIKey | HZZYTSOBMNGFKG-HXUWFJFHSA-N |
| XLogP | 1.77 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|