C24H26N6O2 — CID 118251484
5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]pyrrolidin-3-yl]amino]-1H-pyridin-2-one (PubChem CID 118251484) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]pyrrolidin-3-yl]amino]-1H-pyridin-2-one.
| Compound Name | 5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]pyrrolidin-3-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251484 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 5-[2-(methylamino)-4-pyridinyl]-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]pyrrolidin-3-yl]amino]-1H-pyridin-2-one |
| SMILES | CNc1cc(-c2c[nH]c(=O)c(N[C@@H]3CCN(C(=O)/C=C/Cc4ccccn4)C3)c2)ccn1 |
| InChI | InChI=1S/C24H26N6O2/c1-25-22-14-17(8-11-27-22)18-13-21(24(32)28-15-18)29-20-9-12-30(16-20)23(31)7-4-6-19-5-2-3-10-26-19/h2-5,7-8,10-11,13-15,20,29H,6,9,12,16H2,1H3,(H,25,27)(H,28,32)/b7-4+/t20-/m1/s1 |
| InChIKey | WRMNQIPBDWVKMQ-WWPOYFSUSA-N |
| XLogP | 2.69 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|