C21H27N5O3 — CID 123976002
3-[[(3S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one (PubChem CID 123976002) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[[(3S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one.
| Compound Name | 3-[[(3S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123976002 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 3-[[(3S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one |
| SMILES | COc1cc(-c2c[nH]c(=O)c(N[C@H]3CCN(C(=O)C=CCN(C)C)C3)c2)ccn1 |
| InChI | InChI=1S/C21H27N5O3/c1-25(2)9-4-5-20(27)26-10-7-17(14-26)24-18-11-16(13-23-21(18)28)15-6-8-22-19(12-15)29-3/h4-6,8,11-13,17,24H,7,9-10,14H2,1-3H3,(H,23,28)/t17-/m0/s1 |
| InChIKey | BLWVVBIBRVSVGU-KRWDZBQOSA-N |
| XLogP | 1.58 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|