C18H21N5O2 — CID 118251023
3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 118251023) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251023 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | NC/C=C/C(=O)N1CCC(Nc2cc(-c3ccncc3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C18H21N5O2/c19-6-1-2-17(24)23-9-5-15(12-23)22-16-10-14(11-21-18(16)25)13-3-7-20-8-4-13/h1-4,7-8,10-11,15,22H,5-6,9,12,19H2,(H,21,25)/b2-1+ |
| InChIKey | XYPYZNPNSGREPT-OWOJBTEDSA-N |
| XLogP | 0.96 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|