C18H20N4O2 — CID 118251452
3-[(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 118251452) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251452 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | C=CC(=O)N1CCC(Nc2cc(-c3ccncc3)c[nH]c2=O)CC1 |
| InChI | InChI=1S/C18H20N4O2/c1-2-17(23)22-9-5-15(6-10-22)21-16-11-14(12-20-18(16)24)13-3-7-19-8-4-13/h2-4,7-8,11-12,15,21H,1,5-6,9-10H2,(H,20,24) |
| InChIKey | BAVJWKWCUGEHFU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|