C17H19N5O2 — CID 118251053
5-[4-(methylamino)-2-pyridinyl]-3-[(1-prop-2-enoylazetidin-3-yl)amino]-1H-pyridin-2-one (PubChem CID 118251053) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-[4-(methylamino)-2-pyridinyl]-3-[(1-prop-2-enoylazetidin-3-yl)amino]-1H-pyridin-2-one.
| Compound Name | 5-[4-(methylamino)-2-pyridinyl]-3-[(1-prop-2-enoylazetidin-3-yl)amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251053 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 5-[4-(methylamino)-2-pyridinyl]-3-[(1-prop-2-enoylazetidin-3-yl)amino]-1H-pyridin-2-one |
| SMILES | C=CC(=O)N1CC(Nc2cc(-c3cc(NC)ccn3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C17H19N5O2/c1-3-16(23)22-9-13(10-22)21-15-6-11(8-20-17(15)24)14-7-12(18-2)4-5-19-14/h3-8,13,21H,1,9-10H2,2H3,(H,18,19)(H,20,24) |
| InChIKey | SLBJQFMPDSTHPQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|