C17H21N7O2 — CID 118251391
3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]amino]-5-[6-(methylamino)pyrazin-2-yl]-1H-pyridin-2-one (PubChem CID 118251391) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]amino]-5-[6-(methylamino)pyrazin-2-yl]-1H-pyridin-2-one.
| Compound Name | 3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]amino]-5-[6-(methylamino)pyrazin-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251391 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]amino]-5-[6-(methylamino)pyrazin-2-yl]-1H-pyridin-2-one |
| SMILES | CNc1cncc(-c2c[nH]c(=O)c(NC3CN(C(=O)/C=C/CN)C3)c2)n1 |
| InChI | InChI=1S/C17H21N7O2/c1-19-15-8-20-7-14(23-15)11-5-13(17(26)21-6-11)22-12-9-24(10-12)16(25)3-2-4-18/h2-3,5-8,12,22H,4,9-10,18H2,1H3,(H,19,23)(H,21,26)/b3-2+ |
| InChIKey | NNLHFXVUUVKDCT-NSCUHMNNSA-N |
| XLogP | 0.01 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|