C17H20N6O2 — CID 123940563
3-[[1-[4-(methylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one (PubChem CID 123940563) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-[[1-[4-(methylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[1-[4-(methylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123940563 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[[1-[4-(methylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one |
| SMILES | CNCC=CC(=O)N1CC(Nc2cc(-c3ccncn3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C17H20N6O2/c1-18-5-2-3-16(24)23-9-13(10-23)22-15-7-12(8-20-17(15)25)14-4-6-19-11-21-14/h2-4,6-8,11,13,18,22H,5,9-10H2,1H3,(H,20,25) |
| InChIKey | HGTYKCMVUIMJKS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|