C20H26N6O2 — CID 118251480
3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]methylamino]-5-pyrimidin-4-yl-1H-pyridin-2-one (PubChem CID 118251480) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]methylamino]-5-pyrimidin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]methylamino]-5-pyrimidin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251480 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]methylamino]-5-pyrimidin-4-yl-1H-pyridin-2-one |
| SMILES | CC(C)NC/C=C/C(=O)N1CC(CNc2cc(-c3ccncn3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C20H26N6O2/c1-14(2)22-6-3-4-19(27)26-11-15(12-26)9-23-18-8-16(10-24-20(18)28)17-5-7-21-13-25-17/h3-5,7-8,10,13-15,22-23H,6,9,11-12H2,1-2H3,(H,24,28)/b4-3+ |
| InChIKey | DTBRRSMBTBYVAX-ONEGZZNKSA-N |
| XLogP | 1.26 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|